C20H18N2O3S — CID 24636355
N-(1-naphthalen-1-ylethyl)-2-(4-nitrophenyl)sulfanylacetamide (PubChem CID 24636355) has the molecular formula C20H18N2O3S and a molecular weight of 366.44 g/mol. Its IUPAC name is N-(1-naphthalen-1-ylethyl)-2-(4-nitrophenyl)sulfanylacetamide.
| Compound Name | N-(1-naphthalen-1-ylethyl)-2-(4-nitrophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 24636355 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | N-(1-naphthalen-1-ylethyl)-2-(4-nitrophenyl)sulfanylacetamide |
| SMILES | CC(NC(=O)CSc1ccc([N+](=O)[O-])cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C20H18N2O3S/c1-14(18-8-4-6-15-5-2-3-7-19(15)18)21-20(23)13-26-17-11-9-16(10-12-17)22(24)25/h2-12,14H,13H2,1H3,(H,21,23) |
| InChIKey | DUEHXQLVJPYEIS-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|