C12H14N2O6S — CID 104964356
(2S,3R)-3-hydroxy-2-[[2-(4-nitrophenyl)sulfanylacetyl]amino]butanoic acid (PubChem CID 104964356) has the molecular formula C12H14N2O6S and a molecular weight of 314.32 g/mol. Its IUPAC name is (2S,3R)-3-hydroxy-2-[[2-(4-nitrophenyl)sulfanylacetyl]amino]butanoic acid.
| Compound Name | (2S,3R)-3-hydroxy-2-[[2-(4-nitrophenyl)sulfanylacetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 104964356 |
| Molecular Formula | C12H14N2O6S |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | (2S,3R)-3-hydroxy-2-[[2-(4-nitrophenyl)sulfanylacetyl]amino]butanoic acid |
| SMILES | C[C@@H](O)[C@H](NC(=O)CSc1ccc([N+](=O)[O-])cc1)C(=O)O |
| InChI | InChI=1S/C12H14N2O6S/c1-7(15)11(12(17)18)13-10(16)6-21-9-4-2-8(3-5-9)14(19)20/h2-5,7,11,15H,6H2,1H3,(H,13,16)(H,17,18)/t7-,11+/m1/s1 |
| InChIKey | KCJPPKOGUVJAFZ-HQJQHLMTSA-N |
| XLogP | 0.64 |
| TPSA | 129.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|