C17H20Cl2FN3O — CID 112834271
1-tert-butyl-N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-5-methylpyrazole-3-carboxamide (PubChem CID 112834271) has the molecular formula C17H20Cl2FN3O and a molecular weight of 372.27 g/mol. Its IUPAC name is 1-tert-butyl-N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-5-methylpyrazole-3-carboxamide.
| Compound Name | 1-tert-butyl-N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-5-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 112834271 |
| Molecular Formula | C17H20Cl2FN3O |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 1-tert-butyl-N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-5-methylpyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC(C)c2cc(F)c(Cl)cc2Cl)nn1C(C)(C)C |
| InChI | InChI=1S/C17H20Cl2FN3O/c1-9-6-15(22-23(9)17(3,4)5)16(24)21-10(2)11-7-14(20)13(19)8-12(11)18/h6-8,10H,1-5H3,(H,21,24) |
| InChIKey | BQYHXWRJRWUADG-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|