C18H23Cl2FN4O — CID 55738906
1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]urea (PubChem CID 55738906) has the molecular formula C18H23Cl2FN4O and a molecular weight of 401.31 g/mol. Its IUPAC name is 1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]urea.
| Compound Name | 1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]urea |
|---|---|
| PubChem CID | 55738906 |
| Molecular Formula | C18H23Cl2FN4O |
| Molecular Weight | 401.31 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]urea |
| SMILES | Cc1cc(C)n(CC(C)CNC(=O)NC(C)c2cc(F)c(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C18H23Cl2FN4O/c1-10(9-25-12(3)5-11(2)24-25)8-22-18(26)23-13(4)14-6-17(21)16(20)7-15(14)19/h5-7,10,13H,8-9H2,1-4H3,(H2,22,23,26) |
| InChIKey | YAFXVEFYHWHCGQ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.31 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|