C13H25ClN4O — CID 120828611
1-tert-butyl-5-methyl-N-[2-(methylamino)propyl]pyrazole-3-carboxamide;hydrochloride (PubChem CID 120828611) has the molecular formula C13H25ClN4O and a molecular weight of 288.82 g/mol. Its IUPAC name is 1-tert-butyl-5-methyl-N-[2-(methylamino)propyl]pyrazole-3-carboxamide;hydrochloride.
| Compound Name | 1-tert-butyl-5-methyl-N-[2-(methylamino)propyl]pyrazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120828611 |
| Molecular Formula | C13H25ClN4O |
| Molecular Weight | 288.82 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 1-tert-butyl-5-methyl-N-[2-(methylamino)propyl]pyrazole-3-carboxamide;hydrochloride |
| SMILES | CNC(C)CNC(=O)c1cc(C)n(C(C)(C)C)n1.Cl |
| InChI | InChI=1S/C13H24N4O.ClH/c1-9(14-6)8-15-12(18)11-7-10(2)17(16-11)13(3,4)5;/h7,9,14H,8H2,1-6H3,(H,15,18);1H |
| InChIKey | TXDLXEAFIPGYMZ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.82 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |