C26H39N7O — CID 142229984
1-tert-butyl-N-[(2S)-6-[[4-(dimethylamino)quinazolin-2-yl]amino]-2-methylhexyl]-5-methylpyrazole-3-carboxamide (PubChem CID 142229984) has the molecular formula C26H39N7O and a molecular weight of 465.65 g/mol. Its IUPAC name is 1-tert-butyl-N-[(2S)-6-[[4-(dimethylamino)quinazolin-2-yl]amino]-2-methylhexyl]-5-methylpyrazole-3-carboxamide.
| Compound Name | 1-tert-butyl-N-[(2S)-6-[[4-(dimethylamino)quinazolin-2-yl]amino]-2-methylhexyl]-5-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 142229984 |
| Molecular Formula | C26H39N7O |
| Molecular Weight | 465.65 g/mol |
| Exact Mass | 465.32 |
| IUPAC Name | 1-tert-butyl-N-[(2S)-6-[[4-(dimethylamino)quinazolin-2-yl]amino]-2-methylhexyl]-5-methylpyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC[C@@H](C)CCCCNc2nc(N(C)C)c3ccccc3n2)nn1C(C)(C)C |
| InChI | InChI=1S/C26H39N7O/c1-18(17-28-24(34)22-16-19(2)33(31-22)26(3,4)5)12-10-11-15-27-25-29-21-14-9-8-13-20(21)23(30-25)32(6)7/h8-9,13-14,16,18H,10-12,15,17H2,1-7H3,(H,28,34)(H,27,29,30)/t18-/m0/s1 |
| InChIKey | XLUFMCCQFSEOIF-SFHVURJKSA-N |
| XLogP | 4.60 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.65 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|