C21H24N6O — CID 176907723
3-[[4-[(2,3-dimethylindazol-6-yl)-methylamino]quinazolin-2-yl]amino]propan-1-ol (PubChem CID 176907723) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is 3-[[4-[(2,3-dimethylindazol-6-yl)-methylamino]quinazolin-2-yl]amino]propan-1-ol.
| Compound Name | 3-[[4-[(2,3-dimethylindazol-6-yl)-methylamino]quinazolin-2-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 176907723 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 3-[[4-[(2,3-dimethylindazol-6-yl)-methylamino]quinazolin-2-yl]amino]propan-1-ol |
| SMILES | Cc1c2ccc(N(C)c3nc(NCCCO)nc4ccccc34)cc2nn1C |
| InChI | InChI=1S/C21H24N6O/c1-14-16-10-9-15(13-19(16)25-27(14)3)26(2)20-17-7-4-5-8-18(17)23-21(24-20)22-11-6-12-28/h4-5,7-10,13,28H,6,11-12H2,1-3H3,(H,22,23,24) |
| InChIKey | IFWBQXYHIDZNPV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|