C14H26N4O — CID 120826921
1-tert-butyl-5-ethyl-N-[2-(methylamino)propyl]pyrazole-4-carboxamide (PubChem CID 120826921) has the molecular formula C14H26N4O and a molecular weight of 266.39 g/mol. Its IUPAC name is 1-tert-butyl-5-ethyl-N-[2-(methylamino)propyl]pyrazole-4-carboxamide.
| Compound Name | 1-tert-butyl-5-ethyl-N-[2-(methylamino)propyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 120826921 |
| Molecular Formula | C14H26N4O |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | 1-tert-butyl-5-ethyl-N-[2-(methylamino)propyl]pyrazole-4-carboxamide |
| SMILES | CCc1c(C(=O)NCC(C)NC)cnn1C(C)(C)C |
| InChI | InChI=1S/C14H26N4O/c1-7-12-11(9-17-18(12)14(3,4)5)13(19)16-8-10(2)15-6/h9-10,15H,7-8H2,1-6H3,(H,16,19) |
| InChIKey | GIFPNCFKTMKPDK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |