C20H26N4O4 — CID 119224325
2-[[2-[4-[(1-tert-butyl-5-ethylpyrazole-4-carbonyl)amino]phenyl]acetyl]amino]acetic acid (PubChem CID 119224325) has the molecular formula C20H26N4O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is 2-[[2-[4-[(1-tert-butyl-5-ethylpyrazole-4-carbonyl)amino]phenyl]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[4-[(1-tert-butyl-5-ethylpyrazole-4-carbonyl)amino]phenyl]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 119224325 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 2-[[2-[4-[(1-tert-butyl-5-ethylpyrazole-4-carbonyl)amino]phenyl]acetyl]amino]acetic acid |
| SMILES | CCc1c(C(=O)Nc2ccc(CC(=O)NCC(=O)O)cc2)cnn1C(C)(C)C |
| InChI | InChI=1S/C20H26N4O4/c1-5-16-15(11-22-24(16)20(2,3)4)19(28)23-14-8-6-13(7-9-14)10-17(25)21-12-18(26)27/h6-9,11H,5,10,12H2,1-4H3,(H,21,25)(H,23,28)(H,26,27) |
| InChIKey | JESSCAJGNIGONF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |