C20H27N3O3 — CID 120541354
3-[4-[(1-tert-butyl-5-ethylpyrazole-4-carbonyl)amino]phenyl]-2-methylpropanoic acid (PubChem CID 120541354) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is 3-[4-[(1-tert-butyl-5-ethylpyrazole-4-carbonyl)amino]phenyl]-2-methylpropanoic acid.
| Compound Name | 3-[4-[(1-tert-butyl-5-ethylpyrazole-4-carbonyl)amino]phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 120541354 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 3-[4-[(1-tert-butyl-5-ethylpyrazole-4-carbonyl)amino]phenyl]-2-methylpropanoic acid |
| SMILES | CCc1c(C(=O)Nc2ccc(CC(C)C(=O)O)cc2)cnn1C(C)(C)C |
| InChI | InChI=1S/C20H27N3O3/c1-6-17-16(12-21-23(17)20(3,4)5)18(24)22-15-9-7-14(8-10-15)11-13(2)19(25)26/h7-10,12-13H,6,11H2,1-5H3,(H,22,24)(H,25,26) |
| InChIKey | XODVJPHBRBXYST-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |