C21H29N3O4 — CID 119247083
4-[4-[[(1-tert-butyl-5-ethylpyrazole-4-carbonyl)amino]methyl]phenoxy]butanoic acid (PubChem CID 119247083) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is 4-[4-[[(1-tert-butyl-5-ethylpyrazole-4-carbonyl)amino]methyl]phenoxy]butanoic acid.
| Compound Name | 4-[4-[[(1-tert-butyl-5-ethylpyrazole-4-carbonyl)amino]methyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 119247083 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 4-[4-[[(1-tert-butyl-5-ethylpyrazole-4-carbonyl)amino]methyl]phenoxy]butanoic acid |
| SMILES | CCc1c(C(=O)NCc2ccc(OCCCC(=O)O)cc2)cnn1C(C)(C)C |
| InChI | InChI=1S/C21H29N3O4/c1-5-18-17(14-23-24(18)21(2,3)4)20(27)22-13-15-8-10-16(11-9-15)28-12-6-7-19(25)26/h8-11,14H,5-7,12-13H2,1-4H3,(H,22,27)(H,25,26) |
| InChIKey | MDGWAJLBFQTFOH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|