C18H33ClN4O — CID 119590475
N-(2-amino-1-cyclohexylethyl)-1-tert-butyl-5-ethylpyrazole-4-carboxamide;hydrochloride (PubChem CID 119590475) has the molecular formula C18H33ClN4O and a molecular weight of 356.94 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-1-tert-butyl-5-ethylpyrazole-4-carboxamide;hydrochloride.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-1-tert-butyl-5-ethylpyrazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119590475 |
| Molecular Formula | C18H33ClN4O |
| Molecular Weight | 356.94 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-1-tert-butyl-5-ethylpyrazole-4-carboxamide;hydrochloride |
| SMILES | CCc1c(C(=O)NC(CN)C2CCCCC2)cnn1C(C)(C)C.Cl |
| InChI | InChI=1S/C18H32N4O.ClH/c1-5-16-14(12-20-22(16)18(2,3)4)17(23)21-15(11-19)13-9-7-6-8-10-13;/h12-13,15H,5-11,19H2,1-4H3,(H,21,23);1H |
| InChIKey | GHZCGGULBGALGO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.94 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |