C15H15Cl2FN2O2 — CID 112764288
N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-5-ethyl-3-methyl-1,2-oxazole-4-carboxamide (PubChem CID 112764288) has the molecular formula C15H15Cl2FN2O2 and a molecular weight of 345.20 g/mol. Its IUPAC name is N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-5-ethyl-3-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-5-ethyl-3-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 112764288 |
| Molecular Formula | C15H15Cl2FN2O2 |
| Molecular Weight | 345.20 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-5-ethyl-3-methyl-1,2-oxazole-4-carboxamide |
| SMILES | CCc1onc(C)c1C(=O)NC(C)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H15Cl2FN2O2/c1-4-13-14(8(3)20-22-13)15(21)19-7(2)9-5-12(18)11(17)6-10(9)16/h5-7H,4H2,1-3H3,(H,19,21) |
| InChIKey | LBQVQBHVEWEWMX-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.20 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|