C17H12Cl2FN3O2 — CID 112844831
N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-5-pyridin-4-yl-1,2-oxazole-3-carboxamide (PubChem CID 112844831) has the molecular formula C17H12Cl2FN3O2 and a molecular weight of 380.21 g/mol. Its IUPAC name is N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-5-pyridin-4-yl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-5-pyridin-4-yl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 112844831 |
| Molecular Formula | C17H12Cl2FN3O2 |
| Molecular Weight | 380.21 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-5-pyridin-4-yl-1,2-oxazole-3-carboxamide |
| SMILES | CC(NC(=O)c1cc(-c2ccncc2)on1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H12Cl2FN3O2/c1-9(11-6-14(20)13(19)7-12(11)18)22-17(24)15-8-16(25-23-15)10-2-4-21-5-3-10/h2-9H,1H3,(H,22,24) |
| InChIKey | ZATLIKXMIFISLO-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.21 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|