C14H13Cl2FN2 — CID 43223896
1-(2,4-dichloro-5-fluorophenyl)-N-(pyridin-4-ylmethyl)ethanamine (PubChem CID 43223896) has the molecular formula C14H13Cl2FN2 and a molecular weight of 299.18 g/mol. Its IUPAC name is 1-(2,4-dichloro-5-fluorophenyl)-N-(pyridin-4-ylmethyl)ethanamine.
| Compound Name | 1-(2,4-dichloro-5-fluorophenyl)-N-(pyridin-4-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 43223896 |
| Molecular Formula | C14H13Cl2FN2 |
| Molecular Weight | 299.18 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 1-(2,4-dichloro-5-fluorophenyl)-N-(pyridin-4-ylmethyl)ethanamine |
| SMILES | CC(NCc1ccncc1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H13Cl2FN2/c1-9(19-8-10-2-4-18-5-3-10)11-6-14(17)13(16)7-12(11)15/h2-7,9,19H,8H2,1H3 |
| InChIKey | HXGUBLNALBWATH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.18 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|