C14H15Cl2FN2O — CID 103912719
1-(2,4-dichloro-5-fluorophenyl)-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]ethanamine (PubChem CID 103912719) has the molecular formula C14H15Cl2FN2O and a molecular weight of 317.19 g/mol. Its IUPAC name is 1-(2,4-dichloro-5-fluorophenyl)-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]ethanamine.
| Compound Name | 1-(2,4-dichloro-5-fluorophenyl)-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 103912719 |
| Molecular Formula | C14H15Cl2FN2O |
| Molecular Weight | 317.19 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 1-(2,4-dichloro-5-fluorophenyl)-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]ethanamine |
| SMILES | Cc1nc(CNC(C)c2cc(F)c(Cl)cc2Cl)oc1C |
| InChI | InChI=1S/C14H15Cl2FN2O/c1-7-9(3)20-14(19-7)6-18-8(2)10-4-13(17)12(16)5-11(10)15/h4-5,8,18H,6H2,1-3H3 |
| InChIKey | ADODOHFOJQADAW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.19 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|