C13H14Cl2FN3 — CID 60694556
1-(2,4-dichloro-5-fluorophenyl)-N-(2-imidazol-1-ylethyl)ethanamine (PubChem CID 60694556) has the molecular formula C13H14Cl2FN3 and a molecular weight of 302.18 g/mol. Its IUPAC name is 1-(2,4-dichloro-5-fluorophenyl)-N-(2-imidazol-1-ylethyl)ethanamine.
| Compound Name | 1-(2,4-dichloro-5-fluorophenyl)-N-(2-imidazol-1-ylethyl)ethanamine |
|---|---|
| PubChem CID | 60694556 |
| Molecular Formula | C13H14Cl2FN3 |
| Molecular Weight | 302.18 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 1-(2,4-dichloro-5-fluorophenyl)-N-(2-imidazol-1-ylethyl)ethanamine |
| SMILES | CC(NCCn1ccnc1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H14Cl2FN3/c1-9(18-3-5-19-4-2-17-8-19)10-6-13(16)12(15)7-11(10)14/h2,4,6-9,18H,3,5H2,1H3 |
| InChIKey | QLAQBAXWQFEKAI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.18 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|