C17H17Cl2FN2 — CID 139013842
1-(2,4-dichloro-5-fluorophenyl)-N-(2,3-dihydro-1H-isoindol-5-ylmethyl)ethanamine (PubChem CID 139013842) has the molecular formula C17H17Cl2FN2 and a molecular weight of 339.24 g/mol. Its IUPAC name is 1-(2,4-dichloro-5-fluorophenyl)-N-(2,3-dihydro-1H-isoindol-5-ylmethyl)ethanamine.
| Compound Name | 1-(2,4-dichloro-5-fluorophenyl)-N-(2,3-dihydro-1H-isoindol-5-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 139013842 |
| Molecular Formula | C17H17Cl2FN2 |
| Molecular Weight | 339.24 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 1-(2,4-dichloro-5-fluorophenyl)-N-(2,3-dihydro-1H-isoindol-5-ylmethyl)ethanamine |
| SMILES | CC(NCc1ccc2c(c1)CNC2)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H17Cl2FN2/c1-10(14-5-17(20)16(19)6-15(14)18)22-7-11-2-3-12-8-21-9-13(12)4-11/h2-6,10,21-22H,7-9H2,1H3 |
| InChIKey | HKAUXWIFZMKGMB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.24 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|