C16H17Cl2FN2 — CID 82733903
1-(2,4-dichloro-5-fluorophenyl)-N-[(3-ethyl-2-pyridinyl)methyl]ethanamine (PubChem CID 82733903) has the molecular formula C16H17Cl2FN2 and a molecular weight of 327.23 g/mol. Its IUPAC name is 1-(2,4-dichloro-5-fluorophenyl)-N-[(3-ethyl-2-pyridinyl)methyl]ethanamine.
| Compound Name | 1-(2,4-dichloro-5-fluorophenyl)-N-[(3-ethyl-2-pyridinyl)methyl]ethanamine |
|---|---|
| PubChem CID | 82733903 |
| Molecular Formula | C16H17Cl2FN2 |
| Molecular Weight | 327.23 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 1-(2,4-dichloro-5-fluorophenyl)-N-[(3-ethyl-2-pyridinyl)methyl]ethanamine |
| SMILES | CCc1cccnc1CNC(C)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H17Cl2FN2/c1-3-11-5-4-6-20-16(11)9-21-10(2)12-7-15(19)14(18)8-13(12)17/h4-8,10,21H,3,9H2,1-2H3 |
| InChIKey | OFEJVNXNUMYCLQ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.23 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|