C16H20N2O2 — CID 107707041
5-[1-[(3-ethyl-2-pyridinyl)methylamino]ethyl]benzene-1,3-diol (PubChem CID 107707041) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 5-[1-[(3-ethyl-2-pyridinyl)methylamino]ethyl]benzene-1,3-diol.
| Compound Name | 5-[1-[(3-ethyl-2-pyridinyl)methylamino]ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 107707041 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 5-[1-[(3-ethyl-2-pyridinyl)methylamino]ethyl]benzene-1,3-diol |
| SMILES | CCc1cccnc1CNC(C)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C16H20N2O2/c1-3-12-5-4-6-17-16(12)10-18-11(2)13-7-14(19)9-15(20)8-13/h4-9,11,18-20H,3,10H2,1-2H3 |
| InChIKey | WXGHXZZPEIUJGI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |