C15H13Cl2FN2O3 — CID 9232204
N-[2-[[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]-2-oxoethyl]furan-2-carboxamide (PubChem CID 9232204) has the molecular formula C15H13Cl2FN2O3 and a molecular weight of 359.18 g/mol. Its IUPAC name is N-[2-[[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]-2-oxoethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 9232204 |
| Molecular Formula | C15H13Cl2FN2O3 |
| Molecular Weight | 359.18 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | N-[2-[[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]amino]-2-oxoethyl]furan-2-carboxamide |
| SMILES | C[C@@H](NC(=O)CNC(=O)c1ccco1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H13Cl2FN2O3/c1-8(9-5-12(18)11(17)6-10(9)16)20-14(21)7-19-15(22)13-3-2-4-23-13/h2-6,8H,7H2,1H3,(H,19,22)(H,20,21)/t8-/m1/s1 |
| InChIKey | LGUIFXYSFFANFW-MRVPVSSYSA-N |
| XLogP | 3.33 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.18 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|