C20H22Cl2FN3O2 — CID 56513804
3-[[benzyl(methyl)carbamoyl]amino]-N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]propanamide (PubChem CID 56513804) has the molecular formula C20H22Cl2FN3O2 and a molecular weight of 426.32 g/mol. Its IUPAC name is 3-[[benzyl(methyl)carbamoyl]amino]-N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]propanamide.
| Compound Name | 3-[[benzyl(methyl)carbamoyl]amino]-N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 56513804 |
| Molecular Formula | C20H22Cl2FN3O2 |
| Molecular Weight | 426.32 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 3-[[benzyl(methyl)carbamoyl]amino]-N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]propanamide |
| SMILES | CC(NC(=O)CCNC(=O)N(C)Cc1ccccc1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C20H22Cl2FN3O2/c1-13(15-10-18(23)17(22)11-16(15)21)25-19(27)8-9-24-20(28)26(2)12-14-6-4-3-5-7-14/h3-7,10-11,13H,8-9,12H2,1-2H3,(H,24,28)(H,25,27) |
| InChIKey | YXFPEGLREQHESN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.32 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|