C22H26ClN3O4 — CID 56515220
methyl 3-[3-[[benzyl(methyl)carbamoyl]amino]propanoylamino]-3-(4-chlorophenyl)propanoate (PubChem CID 56515220) has the molecular formula C22H26ClN3O4 and a molecular weight of 431.92 g/mol. Its IUPAC name is methyl 3-[3-[[benzyl(methyl)carbamoyl]amino]propanoylamino]-3-(4-chlorophenyl)propanoate.
| Compound Name | methyl 3-[3-[[benzyl(methyl)carbamoyl]amino]propanoylamino]-3-(4-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 56515220 |
| Molecular Formula | C22H26ClN3O4 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | methyl 3-[3-[[benzyl(methyl)carbamoyl]amino]propanoylamino]-3-(4-chlorophenyl)propanoate |
| SMILES | COC(=O)CC(NC(=O)CCNC(=O)N(C)Cc1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H26ClN3O4/c1-26(15-16-6-4-3-5-7-16)22(29)24-13-12-20(27)25-19(14-21(28)30-2)17-8-10-18(23)11-9-17/h3-11,19H,12-15H2,1-2H3,(H,24,29)(H,25,27) |
| InChIKey | PVRROIMFOOTOOE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |