C24H31N3O5 — CID 56581674
ethyl 3-[3-[[benzyl(methyl)carbamoyl]amino]propanoylamino]-3-(3-methoxyphenyl)propanoate (PubChem CID 56581674) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is ethyl 3-[3-[[benzyl(methyl)carbamoyl]amino]propanoylamino]-3-(3-methoxyphenyl)propanoate.
| Compound Name | ethyl 3-[3-[[benzyl(methyl)carbamoyl]amino]propanoylamino]-3-(3-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 56581674 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | ethyl 3-[3-[[benzyl(methyl)carbamoyl]amino]propanoylamino]-3-(3-methoxyphenyl)propanoate |
| SMILES | CCOC(=O)CC(NC(=O)CCNC(=O)N(C)Cc1ccccc1)c1cccc(OC)c1 |
| InChI | InChI=1S/C24H31N3O5/c1-4-32-23(29)16-21(19-11-8-12-20(15-19)31-3)26-22(28)13-14-25-24(30)27(2)17-18-9-6-5-7-10-18/h5-12,15,21H,4,13-14,16-17H2,1-3H3,(H,25,30)(H,26,28) |
| InChIKey | ZCUPXNMUVCZLBA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |