C18H18Cl2F2N2O — CID 55910328
3-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-1-[1-(2-fluorophenyl)ethyl]-1-methylurea (PubChem CID 55910328) has the molecular formula C18H18Cl2F2N2O and a molecular weight of 387.26 g/mol. Its IUPAC name is 3-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-1-[1-(2-fluorophenyl)ethyl]-1-methylurea.
| Compound Name | 3-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-1-[1-(2-fluorophenyl)ethyl]-1-methylurea |
|---|---|
| PubChem CID | 55910328 |
| Molecular Formula | C18H18Cl2F2N2O |
| Molecular Weight | 387.26 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 3-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-1-[1-(2-fluorophenyl)ethyl]-1-methylurea |
| SMILES | CC(NC(=O)N(C)C(C)c1ccccc1F)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C18H18Cl2F2N2O/c1-10(13-8-17(22)15(20)9-14(13)19)23-18(25)24(3)11(2)12-6-4-5-7-16(12)21/h4-11H,1-3H3,(H,23,25) |
| InChIKey | ZKGJJPJSGGAMBY-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.26 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|