C22H19Cl2FN2O3 — CID 112764329
N-[1-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]-1-oxo-3-phenylpropan-2-yl]furan-2-carboxamide (PubChem CID 112764329) has the molecular formula C22H19Cl2FN2O3 and a molecular weight of 449.31 g/mol. Its IUPAC name is N-[1-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]-1-oxo-3-phenylpropan-2-yl]furan-2-carboxamide.
| Compound Name | N-[1-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]-1-oxo-3-phenylpropan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 112764329 |
| Molecular Formula | C22H19Cl2FN2O3 |
| Molecular Weight | 449.31 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | N-[1-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]-1-oxo-3-phenylpropan-2-yl]furan-2-carboxamide |
| SMILES | CC(NC(=O)C(Cc1ccccc1)NC(=O)c1ccco1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C22H19Cl2FN2O3/c1-13(15-11-18(25)17(24)12-16(15)23)26-21(28)19(10-14-6-3-2-4-7-14)27-22(29)20-8-5-9-30-20/h2-9,11-13,19H,10H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | SLCJIWKLLJHZJZ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.31 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|