C14H16Cl2FNO2 — CID 30972064
N-[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]oxane-4-carboxamide (PubChem CID 30972064) has the molecular formula C14H16Cl2FNO2 and a molecular weight of 320.19 g/mol. Its IUPAC name is N-[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]oxane-4-carboxamide.
| Compound Name | N-[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 30972064 |
| Molecular Formula | C14H16Cl2FNO2 |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | N-[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]oxane-4-carboxamide |
| SMILES | C[C@@H](NC(=O)C1CCOCC1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H16Cl2FNO2/c1-8(10-6-13(17)12(16)7-11(10)15)18-14(19)9-2-4-20-5-3-9/h6-9H,2-5H2,1H3,(H,18,19)/t8-/m1/s1 |
| InChIKey | BUSBVYCIKMNNSE-MRVPVSSYSA-N |
| XLogP | 3.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|