C15H16Cl2FN3O — CID 94800670
4-cyano-N-[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]piperidine-1-carboxamide (PubChem CID 94800670) has the molecular formula C15H16Cl2FN3O and a molecular weight of 344.22 g/mol. Its IUPAC name is 4-cyano-N-[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]piperidine-1-carboxamide.
| Compound Name | 4-cyano-N-[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 94800670 |
| Molecular Formula | C15H16Cl2FN3O |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 4-cyano-N-[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]piperidine-1-carboxamide |
| SMILES | C[C@@H](NC(=O)N1CCC(C#N)CC1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H16Cl2FN3O/c1-9(11-6-14(18)13(17)7-12(11)16)20-15(22)21-4-2-10(8-19)3-5-21/h6-7,9-10H,2-5H2,1H3,(H,20,22)/t9-/m1/s1 |
| InChIKey | LACSVIQBPSSIJX-SECBINFHSA-N |
| XLogP | 4.14 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|