About 4-cyano-N-[(1S)-1-(3,4-dichlorophenyl)ethyl]piperidine-1-carboxamide
4-cyano-N-[(1S)-1-(3,4-dichlorophenyl)ethyl]piperidine-1-carboxamide (PubChem CID 95284112) has the molecular formula C15H17Cl2N3O
and a molecular weight of 326.23 g/mol. Its IUPAC name is 4-cyano-N-[(1S)-1-(3,4-dichlorophenyl)ethyl]piperidine-1-carboxamide.
Molecular Properties
| Compound Name | 4-cyano-N-[(1S)-1-(3,4-dichlorophenyl)ethyl]piperidine-1-carboxamide |
| PubChem CID | 95284112 |
| Molecular Formula | C15H17Cl2N3O |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 4-cyano-N-[(1S)-1-(3,4-dichlorophenyl)ethyl]piperidine-1-carboxamide |
| SMILES | C[C@H](NC(=O)N1CCC(C#N)CC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H17Cl2N3O/c1-10(12-2-3-13(16)14(17)8-12)19-15(21)20-6-4-11(9-18)5-7-20/h2-3,8,10-11H,4-7H2,1H3,(H,19,21)/t10-/m0/s1 |
| InChIKey | TUVCFZAWNLJBGE-JTQLQIEISA-N |
| XLogP | 4.00 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-cyano-N-[(1S)-1-(3,4-dichlorophenyl)ethyl]piperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyano-N-[(1S)-1-(3,4-dichlorophenyl)ethyl]piperidine-1-carboxamide?
The IUPAC name of 4-cyano-N-[(1S)-1-(3,4-dichlorophenyl)ethyl]piperidine-1-carboxamide (CID 95284112) is 4-cyano-N-[(1S)-1-(3,4-dichlorophenyl)ethyl]piperidine-1-carboxamide.
What is the SMILES notation for 4-cyano-N-[(1S)-1-(3,4-dichlorophenyl)ethyl]piperidine-1-carboxamide?
The canonical SMILES for 4-cyano-N-[(1S)-1-(3,4-dichlorophenyl)ethyl]piperidine-1-carboxamide is C[C@H](NC(=O)N1CCC(C#N)CC1)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 4-cyano-N-[(1S)-1-(3,4-dichlorophenyl)ethyl]piperidine-1-carboxamide?
The InChIKey is TUVCFZAWNLJBGE-JTQLQIEISA-N. The full InChI is InChI=1S/C15H17Cl2N3O/c1-10(12-2-3-13(16)14(17)8-12)19-15(21)20-6-4-11(9-18)5-7-20/h2-3,8,10-11H,4-7H2,1H3,(H,19,21)/t10-/m0/s1.
What are the key properties of 4-cyano-N-[(1S)-1-(3,4-dichlorophenyl)ethyl]piperidine-1-carboxamide?
4-cyano-N-[(1S)-1-(3,4-dichlorophenyl)ethyl]piperidine-1-carboxamide has a molecular weight of 326.23 g/mol, XLogP of 4.00, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyano-N-[(1S)-1-(3,4-dichlorophenyl)ethyl]piperidine-1-carboxamide is sourced from PubChem (CID 95284112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).