C16H20ClFN2O3 — CID 124562986
methyl 1-[[(1S)-1-(3-chloro-4-fluorophenyl)ethyl]carbamoyl]piperidine-4-carboxylate (PubChem CID 124562986) has the molecular formula C16H20ClFN2O3 and a molecular weight of 342.80 g/mol. Its IUPAC name is methyl 1-[[(1S)-1-(3-chloro-4-fluorophenyl)ethyl]carbamoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[[(1S)-1-(3-chloro-4-fluorophenyl)ethyl]carbamoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 124562986 |
| Molecular Formula | C16H20ClFN2O3 |
| Molecular Weight | 342.80 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | methyl 1-[[(1S)-1-(3-chloro-4-fluorophenyl)ethyl]carbamoyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)N[C@@H](C)c2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C16H20ClFN2O3/c1-10(12-3-4-14(18)13(17)9-12)19-16(22)20-7-5-11(6-8-20)15(21)23-2/h3-4,9-11H,5-8H2,1-2H3,(H,19,22)/t10-/m0/s1 |
| InChIKey | XXGOYCIEXKNFLS-JTQLQIEISA-N |
| XLogP | 3.13 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.80 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |