C16H22FN3O3 — CID 94492379
1-N-[(1S)-1-(3-fluoro-4-methoxyphenyl)ethyl]piperidine-1,4-dicarboxamide (PubChem CID 94492379) has the molecular formula C16H22FN3O3 and a molecular weight of 323.37 g/mol. Its IUPAC name is 1-N-[(1S)-1-(3-fluoro-4-methoxyphenyl)ethyl]piperidine-1,4-dicarboxamide.
| Compound Name | 1-N-[(1S)-1-(3-fluoro-4-methoxyphenyl)ethyl]piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 94492379 |
| Molecular Formula | C16H22FN3O3 |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 1-N-[(1S)-1-(3-fluoro-4-methoxyphenyl)ethyl]piperidine-1,4-dicarboxamide |
| SMILES | COc1ccc([C@H](C)NC(=O)N2CCC(C(N)=O)CC2)cc1F |
| InChI | InChI=1S/C16H22FN3O3/c1-10(12-3-4-14(23-2)13(17)9-12)19-16(22)20-7-5-11(6-8-20)15(18)21/h3-4,9-11H,5-8H2,1-2H3,(H2,18,21)(H,19,22)/t10-/m0/s1 |
| InChIKey | OTJFIOKYLOWLSY-JTQLQIEISA-N |
| XLogP | 1.80 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |