C18H27N3O2S — CID 95347473
1-N-[(1S)-1-(4-propan-2-ylsulfanylphenyl)ethyl]piperidine-1,4-dicarboxamide (PubChem CID 95347473) has the molecular formula C18H27N3O2S and a molecular weight of 349.50 g/mol. Its IUPAC name is 1-N-[(1S)-1-(4-propan-2-ylsulfanylphenyl)ethyl]piperidine-1,4-dicarboxamide.
| Compound Name | 1-N-[(1S)-1-(4-propan-2-ylsulfanylphenyl)ethyl]piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 95347473 |
| Molecular Formula | C18H27N3O2S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 1-N-[(1S)-1-(4-propan-2-ylsulfanylphenyl)ethyl]piperidine-1,4-dicarboxamide |
| SMILES | CC(C)Sc1ccc([C@H](C)NC(=O)N2CCC(C(N)=O)CC2)cc1 |
| InChI | InChI=1S/C18H27N3O2S/c1-12(2)24-16-6-4-14(5-7-16)13(3)20-18(23)21-10-8-15(9-11-21)17(19)22/h4-7,12-13,15H,8-11H2,1-3H3,(H2,19,22)(H,20,23)/t13-/m0/s1 |
| InChIKey | GDJUJQXTVLJENB-ZDUSSCGKSA-N |
| XLogP | 3.15 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |