C24H37N3O2S — CID 86889681
1-[1-(cyclohexanecarbonyl)piperidin-4-yl]-3-[1-(4-propan-2-ylsulfanylphenyl)ethyl]urea (PubChem CID 86889681) has the molecular formula C24H37N3O2S and a molecular weight of 431.65 g/mol. Its IUPAC name is 1-[1-(cyclohexanecarbonyl)piperidin-4-yl]-3-[1-(4-propan-2-ylsulfanylphenyl)ethyl]urea.
| Compound Name | 1-[1-(cyclohexanecarbonyl)piperidin-4-yl]-3-[1-(4-propan-2-ylsulfanylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 86889681 |
| Molecular Formula | C24H37N3O2S |
| Molecular Weight | 431.65 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | 1-[1-(cyclohexanecarbonyl)piperidin-4-yl]-3-[1-(4-propan-2-ylsulfanylphenyl)ethyl]urea |
| SMILES | CC(C)Sc1ccc(C(C)NC(=O)NC2CCN(C(=O)C3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C24H37N3O2S/c1-17(2)30-22-11-9-19(10-12-22)18(3)25-24(29)26-21-13-15-27(16-14-21)23(28)20-7-5-4-6-8-20/h9-12,17-18,20-21H,4-8,13-16H2,1-3H3,(H2,25,26,29) |
| InChIKey | AZTCKJQKWVQYMV-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.65 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |