C20H31N3O — CID 100744989
1-cyclohexyl-3-[(1S)-1-(4-piperidin-1-ylphenyl)ethyl]urea (PubChem CID 100744989) has the molecular formula C20H31N3O and a molecular weight of 329.49 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(1S)-1-(4-piperidin-1-ylphenyl)ethyl]urea.
| Compound Name | 1-cyclohexyl-3-[(1S)-1-(4-piperidin-1-ylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 100744989 |
| Molecular Formula | C20H31N3O |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.25 |
| IUPAC Name | 1-cyclohexyl-3-[(1S)-1-(4-piperidin-1-ylphenyl)ethyl]urea |
| SMILES | C[C@H](NC(=O)NC1CCCCC1)c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H31N3O/c1-16(21-20(24)22-18-8-4-2-5-9-18)17-10-12-19(13-11-17)23-14-6-3-7-15-23/h10-13,16,18H,2-9,14-15H2,1H3,(H2,21,22,24)/t16-/m0/s1 |
| InChIKey | HDFCAUSVQXVNPD-INIZCTEOSA-N |
| XLogP | 4.37 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|