C16H21ClN2O3 — CID 122017510
4-[[(1R)-1-(4-chlorophenyl)ethyl]carbamoylamino]cyclohexane-1-carboxylic acid (PubChem CID 122017510) has the molecular formula C16H21ClN2O3 and a molecular weight of 324.81 g/mol. Its IUPAC name is 4-[[(1R)-1-(4-chlorophenyl)ethyl]carbamoylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[(1R)-1-(4-chlorophenyl)ethyl]carbamoylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122017510 |
| Molecular Formula | C16H21ClN2O3 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 4-[[(1R)-1-(4-chlorophenyl)ethyl]carbamoylamino]cyclohexane-1-carboxylic acid |
| SMILES | C[C@@H](NC(=O)NC1CCC(C(=O)O)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H21ClN2O3/c1-10(11-2-6-13(17)7-3-11)18-16(22)19-14-8-4-12(5-9-14)15(20)21/h2-3,6-7,10,12,14H,4-5,8-9H2,1H3,(H,20,21)(H2,18,19,22)/t10-,12?,14?/m1/s1 |
| InChIKey | OOSIAHVVTQEEIK-PWQPVHBWSA-N |
| XLogP | 3.34 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |