C22H33N3O2 — CID 86861417
4-(cyclohexanecarbonylamino)-N-[1-(4-methylphenyl)ethyl]piperidine-1-carboxamide (PubChem CID 86861417) has the molecular formula C22H33N3O2 and a molecular weight of 371.52 g/mol. Its IUPAC name is 4-(cyclohexanecarbonylamino)-N-[1-(4-methylphenyl)ethyl]piperidine-1-carboxamide.
| Compound Name | 4-(cyclohexanecarbonylamino)-N-[1-(4-methylphenyl)ethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 86861417 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | 4-(cyclohexanecarbonylamino)-N-[1-(4-methylphenyl)ethyl]piperidine-1-carboxamide |
| SMILES | Cc1ccc(C(C)NC(=O)N2CCC(NC(=O)C3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C22H33N3O2/c1-16-8-10-18(11-9-16)17(2)23-22(27)25-14-12-20(13-15-25)24-21(26)19-6-4-3-5-7-19/h8-11,17,19-20H,3-7,12-15H2,1-2H3,(H,23,27)(H,24,26) |
| InChIKey | WPRSZOIZVOZXFO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |