C18H28N2O2S — CID 111438676
N-[1-(4-ethylsulfanylphenyl)ethyl]-4-(1-hydroxyethyl)piperidine-1-carboxamide (PubChem CID 111438676) has the molecular formula C18H28N2O2S and a molecular weight of 336.50 g/mol. Its IUPAC name is N-[1-(4-ethylsulfanylphenyl)ethyl]-4-(1-hydroxyethyl)piperidine-1-carboxamide.
| Compound Name | N-[1-(4-ethylsulfanylphenyl)ethyl]-4-(1-hydroxyethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 111438676 |
| Molecular Formula | C18H28N2O2S |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | N-[1-(4-ethylsulfanylphenyl)ethyl]-4-(1-hydroxyethyl)piperidine-1-carboxamide |
| SMILES | CCSc1ccc(C(C)NC(=O)N2CCC(C(C)O)CC2)cc1 |
| InChI | InChI=1S/C18H28N2O2S/c1-4-23-17-7-5-15(6-8-17)13(2)19-18(22)20-11-9-16(10-12-20)14(3)21/h5-8,13-14,16,21H,4,9-12H2,1-3H3,(H,19,22) |
| InChIKey | SCVZBZMRZGXPGP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |