C18H27N3O4 — CID 56808444
1-N-[1-(4-ethoxy-3-methoxyphenyl)ethyl]piperidine-1,4-dicarboxamide (PubChem CID 56808444) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is 1-N-[1-(4-ethoxy-3-methoxyphenyl)ethyl]piperidine-1,4-dicarboxamide.
| Compound Name | 1-N-[1-(4-ethoxy-3-methoxyphenyl)ethyl]piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 56808444 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 1-N-[1-(4-ethoxy-3-methoxyphenyl)ethyl]piperidine-1,4-dicarboxamide |
| SMILES | CCOc1ccc(C(C)NC(=O)N2CCC(C(N)=O)CC2)cc1OC |
| InChI | InChI=1S/C18H27N3O4/c1-4-25-15-6-5-14(11-16(15)24-3)12(2)20-18(23)21-9-7-13(8-10-21)17(19)22/h5-6,11-13H,4,7-10H2,1-3H3,(H2,19,22)(H,20,23) |
| InChIKey | ZPJBTMHJKMAZDT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |