C17H25N3O3 — CID 56798078
1-N-[1-(2-methoxyphenyl)propan-2-yl]piperidine-1,4-dicarboxamide (PubChem CID 56798078) has the molecular formula C17H25N3O3 and a molecular weight of 319.40 g/mol. Its IUPAC name is 1-N-[1-(2-methoxyphenyl)propan-2-yl]piperidine-1,4-dicarboxamide.
| Compound Name | 1-N-[1-(2-methoxyphenyl)propan-2-yl]piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 56798078 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 1-N-[1-(2-methoxyphenyl)propan-2-yl]piperidine-1,4-dicarboxamide |
| SMILES | COc1ccccc1CC(C)NC(=O)N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C17H25N3O3/c1-12(11-14-5-3-4-6-15(14)23-2)19-17(22)20-9-7-13(8-10-20)16(18)21/h3-6,12-13H,7-11H2,1-2H3,(H2,18,21)(H,19,22) |
| InChIKey | KLZYFBMVGNPKBL-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |