C22H28FN3O2 — CID 87002643
4-benzyl-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-1,4-diazepane-1-carboxamide (PubChem CID 87002643) has the molecular formula C22H28FN3O2 and a molecular weight of 385.48 g/mol. Its IUPAC name is 4-benzyl-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-1,4-diazepane-1-carboxamide.
| Compound Name | 4-benzyl-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 87002643 |
| Molecular Formula | C22H28FN3O2 |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 4-benzyl-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-1,4-diazepane-1-carboxamide |
| SMILES | COc1ccc(C(C)NC(=O)N2CCCN(Cc3ccccc3)CC2)cc1F |
| InChI | InChI=1S/C22H28FN3O2/c1-17(19-9-10-21(28-2)20(23)15-19)24-22(27)26-12-6-11-25(13-14-26)16-18-7-4-3-5-8-18/h3-5,7-10,15,17H,6,11-14,16H2,1-2H3,(H,24,27) |
| InChIKey | JBKBLXULCSDJJU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |