C24H30FN3O2 — CID 45356192
2-[4-[(3-fluoro-4-methoxyphenyl)methyl]piperazin-1-yl]-2-phenyl-1-pyrrolidin-1-ylethanone (PubChem CID 45356192) has the molecular formula C24H30FN3O2 and a molecular weight of 411.52 g/mol. Its IUPAC name is 2-[4-[(3-fluoro-4-methoxyphenyl)methyl]piperazin-1-yl]-2-phenyl-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[4-[(3-fluoro-4-methoxyphenyl)methyl]piperazin-1-yl]-2-phenyl-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 45356192 |
| Molecular Formula | C24H30FN3O2 |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 2-[4-[(3-fluoro-4-methoxyphenyl)methyl]piperazin-1-yl]-2-phenyl-1-pyrrolidin-1-ylethanone |
| SMILES | COc1ccc(CN2CCN(C(C(=O)N3CCCC3)c3ccccc3)CC2)cc1F |
| InChI | InChI=1S/C24H30FN3O2/c1-30-22-10-9-19(17-21(22)25)18-26-13-15-27(16-14-26)23(20-7-3-2-4-8-20)24(29)28-11-5-6-12-28/h2-4,7-10,17,23H,5-6,11-16,18H2,1H3 |
| InChIKey | ACPRYDOBKANVKK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |