About 4-(3,4-dichlorobenzoyl)-N-[(1S)-1-(2-methylphenyl)ethyl]piperidine-1-carboxamide
4-(3,4-dichlorobenzoyl)-N-[(1S)-1-(2-methylphenyl)ethyl]piperidine-1-carboxamide (PubChem CID 97007454) has the molecular formula C22H24Cl2N2O2
and a molecular weight of 419.35 g/mol. Its IUPAC name is 4-(3,4-dichlorobenzoyl)-N-[(1S)-1-(2-methylphenyl)ethyl]piperidine-1-carboxamide.
Molecular Properties
| Compound Name | 4-(3,4-dichlorobenzoyl)-N-[(1S)-1-(2-methylphenyl)ethyl]piperidine-1-carboxamide |
| PubChem CID | 97007454 |
| Molecular Formula | C22H24Cl2N2O2 |
| Molecular Weight | 419.35 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 4-(3,4-dichlorobenzoyl)-N-[(1S)-1-(2-methylphenyl)ethyl]piperidine-1-carboxamide |
| SMILES | Cc1ccccc1[C@H](C)NC(=O)N1CCC(C(=O)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C22H24Cl2N2O2/c1-14-5-3-4-6-18(14)15(2)25-22(28)26-11-9-16(10-12-26)21(27)17-7-8-19(23)20(24)13-17/h3-8,13,15-16H,9-12H2,1-2H3,(H,25,28)/t15-/m0/s1 |
| InChIKey | WVGLNRLJOYEVAC-HNNXBMFYSA-N |
| XLogP | 5.67 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.35 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(3,4-dichlorobenzoyl)-N-[(1S)-1-(2-methylphenyl)ethyl]piperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dichlorobenzoyl)-N-[(1S)-1-(2-methylphenyl)ethyl]piperidine-1-carboxamide?
The IUPAC name of 4-(3,4-dichlorobenzoyl)-N-[(1S)-1-(2-methylphenyl)ethyl]piperidine-1-carboxamide (CID 97007454) is 4-(3,4-dichlorobenzoyl)-N-[(1S)-1-(2-methylphenyl)ethyl]piperidine-1-carboxamide.
What is the SMILES notation for 4-(3,4-dichlorobenzoyl)-N-[(1S)-1-(2-methylphenyl)ethyl]piperidine-1-carboxamide?
The canonical SMILES for 4-(3,4-dichlorobenzoyl)-N-[(1S)-1-(2-methylphenyl)ethyl]piperidine-1-carboxamide is Cc1ccccc1[C@H](C)NC(=O)N1CCC(C(=O)c2ccc(Cl)c(Cl)c2)CC1.
What is the InChIKey of 4-(3,4-dichlorobenzoyl)-N-[(1S)-1-(2-methylphenyl)ethyl]piperidine-1-carboxamide?
The InChIKey is WVGLNRLJOYEVAC-HNNXBMFYSA-N. The full InChI is InChI=1S/C22H24Cl2N2O2/c1-14-5-3-4-6-18(14)15(2)25-22(28)26-11-9-16(10-12-26)21(27)17-7-8-19(23)20(24)13-17/h3-8,13,15-16H,9-12H2,1-2H3,(H,25,28)/t15-/m0/s1.
What are the key properties of 4-(3,4-dichlorobenzoyl)-N-[(1S)-1-(2-methylphenyl)ethyl]piperidine-1-carboxamide?
4-(3,4-dichlorobenzoyl)-N-[(1S)-1-(2-methylphenyl)ethyl]piperidine-1-carboxamide has a molecular weight of 419.35 g/mol, XLogP of 5.67, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dichlorobenzoyl)-N-[(1S)-1-(2-methylphenyl)ethyl]piperidine-1-carboxamide is sourced from PubChem (CID 97007454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).