C17H24Cl2FN3O3S — CID 112823432
N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-4-(propylsulfonylamino)piperidine-1-carboxamide (PubChem CID 112823432) has the molecular formula C17H24Cl2FN3O3S and a molecular weight of 440.37 g/mol. Its IUPAC name is N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-4-(propylsulfonylamino)piperidine-1-carboxamide.
| Compound Name | N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-4-(propylsulfonylamino)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 112823432 |
| Molecular Formula | C17H24Cl2FN3O3S |
| Molecular Weight | 440.37 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-4-(propylsulfonylamino)piperidine-1-carboxamide |
| SMILES | CCCS(=O)(=O)NC1CCN(C(=O)NC(C)c2cc(F)c(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C17H24Cl2FN3O3S/c1-3-8-27(25,26)22-12-4-6-23(7-5-12)17(24)21-11(2)13-9-16(20)15(19)10-14(13)18/h9-12,22H,3-8H2,1-2H3,(H,21,24) |
| InChIKey | IIIMXTLOBQYKII-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.37 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|