C16H21Cl2FN2O — CID 112831924
1-(cyclopropylmethyl)-3-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-1-propylurea (PubChem CID 112831924) has the molecular formula C16H21Cl2FN2O and a molecular weight of 347.26 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-3-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-1-propylurea.
| Compound Name | 1-(cyclopropylmethyl)-3-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-1-propylurea |
|---|---|
| PubChem CID | 112831924 |
| Molecular Formula | C16H21Cl2FN2O |
| Molecular Weight | 347.26 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 1-(cyclopropylmethyl)-3-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-1-propylurea |
| SMILES | CCCN(CC1CC1)C(=O)NC(C)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H21Cl2FN2O/c1-3-6-21(9-11-4-5-11)16(22)20-10(2)12-7-15(19)14(18)8-13(12)17/h7-8,10-11H,3-6,9H2,1-2H3,(H,20,22) |
| InChIKey | FJZSEWNSWQQANH-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.26 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|