C18H15Cl2FN4OS — CID 112764223
N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-4-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzamide (PubChem CID 112764223) has the molecular formula C18H15Cl2FN4OS and a molecular weight of 425.32 g/mol. Its IUPAC name is N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-4-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzamide.
| Compound Name | N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-4-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzamide |
|---|---|
| PubChem CID | 112764223 |
| Molecular Formula | C18H15Cl2FN4OS |
| Molecular Weight | 425.32 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | N-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-4-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzamide |
| SMILES | CC(NC(=O)c1ccc(CSc2ncn[nH]2)cc1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C18H15Cl2FN4OS/c1-10(13-6-16(21)15(20)7-14(13)19)24-17(26)12-4-2-11(3-5-12)8-27-18-22-9-23-25-18/h2-7,9-10H,8H2,1H3,(H,24,26)(H,22,23,25) |
| InChIKey | GDXXMMWSAZWHOV-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.32 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|