C15H21N3O2 — CID 99787469
(2S)-2-[1,3-benzoxazol-2-yl(methyl)amino]-N-tert-butylpropanamide (PubChem CID 99787469) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is (2S)-2-[1,3-benzoxazol-2-yl(methyl)amino]-N-tert-butylpropanamide.
| Compound Name | (2S)-2-[1,3-benzoxazol-2-yl(methyl)amino]-N-tert-butylpropanamide |
|---|---|
| PubChem CID | 99787469 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | (2S)-2-[1,3-benzoxazol-2-yl(methyl)amino]-N-tert-butylpropanamide |
| SMILES | C[C@@H](C(=O)NC(C)(C)C)N(C)c1nc2ccccc2o1 |
| InChI | InChI=1S/C15H21N3O2/c1-10(13(19)17-15(2,3)4)18(5)14-16-11-8-6-7-9-12(11)20-14/h6-10H,1-5H3,(H,17,19)/t10-/m0/s1 |
| InChIKey | SWCFWUPWLBTCJJ-JTQLQIEISA-N |
| XLogP | 2.57 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |