C12H16N2O2 — CID 115865807
3-(1,3-benzoxazol-2-ylamino)-3-methylbutan-2-ol (PubChem CID 115865807) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-ylamino)-3-methylbutan-2-ol.
| Compound Name | 3-(1,3-benzoxazol-2-ylamino)-3-methylbutan-2-ol |
|---|---|
| PubChem CID | 115865807 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 3-(1,3-benzoxazol-2-ylamino)-3-methylbutan-2-ol |
| SMILES | CC(O)C(C)(C)Nc1nc2ccccc2o1 |
| InChI | InChI=1S/C12H16N2O2/c1-8(15)12(2,3)14-11-13-9-6-4-5-7-10(9)16-11/h4-8,15H,1-3H3,(H,13,14) |
| InChIKey | FZYYTUDKASAKRL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |