C14H21N3O — CID 113283917
2-N-(1,3-benzoxazol-2-yl)-2,4-dimethylpentane-1,2-diamine (PubChem CID 113283917) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-N-(1,3-benzoxazol-2-yl)-2,4-dimethylpentane-1,2-diamine.
| Compound Name | 2-N-(1,3-benzoxazol-2-yl)-2,4-dimethylpentane-1,2-diamine |
|---|---|
| PubChem CID | 113283917 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 2-N-(1,3-benzoxazol-2-yl)-2,4-dimethylpentane-1,2-diamine |
| SMILES | CC(C)CC(C)(CN)Nc1nc2ccccc2o1 |
| InChI | InChI=1S/C14H21N3O/c1-10(2)8-14(3,9-15)17-13-16-11-6-4-5-7-12(11)18-13/h4-7,10H,8-9,15H2,1-3H3,(H,16,17) |
| InChIKey | HJQQCDWNVGOAFS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |