C13H16N2O — CID 103703598
N-(2-cyclopropylpropan-2-yl)-1,3-benzoxazol-2-amine (PubChem CID 103703598) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is N-(2-cyclopropylpropan-2-yl)-1,3-benzoxazol-2-amine.
| Compound Name | N-(2-cyclopropylpropan-2-yl)-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 103703598 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | N-(2-cyclopropylpropan-2-yl)-1,3-benzoxazol-2-amine |
| SMILES | CC(C)(Nc1nc2ccccc2o1)C1CC1 |
| InChI | InChI=1S/C13H16N2O/c1-13(2,9-7-8-9)15-12-14-10-5-3-4-6-11(10)16-12/h3-6,9H,7-8H2,1-2H3,(H,14,15) |
| InChIKey | AIMMLAWGDWFMER-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |