C22H20N2O — CID 102300839
N-methyl-5-phenyl-N-[(1R)-1-phenylethyl]-1,3-benzoxazol-2-amine (PubChem CID 102300839) has the molecular formula C22H20N2O and a molecular weight of 328.42 g/mol. Its IUPAC name is N-methyl-5-phenyl-N-[(1R)-1-phenylethyl]-1,3-benzoxazol-2-amine.
| Compound Name | N-methyl-5-phenyl-N-[(1R)-1-phenylethyl]-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 102300839 |
| Molecular Formula | C22H20N2O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | N-methyl-5-phenyl-N-[(1R)-1-phenylethyl]-1,3-benzoxazol-2-amine |
| SMILES | C[C@H](c1ccccc1)N(C)c1nc2cc(-c3ccccc3)ccc2o1 |
| InChI | InChI=1S/C22H20N2O/c1-16(17-9-5-3-6-10-17)24(2)22-23-20-15-19(13-14-21(20)25-22)18-11-7-4-8-12-18/h3-16H,1-2H3/t16-/m1/s1 |
| InChIKey | ZSNYRWDNRVMAOS-MRXNPFEDSA-N |
| XLogP | 5.69 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |